Products 83443-28-1
CAS 83443-28-1 appears in our catalog under these names: 2-Chloro-n-(2-[(cyanomethyl)thio]phenyl)acetamide, 95%, 2-Chloro-N-{2-((cyanomethyl)sulfanyl)phenyl}acetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
2-chloro-N-[2-(cyanomethylsulfanyl)phenyl]acetamide (CAS 83443-28-1) is a chemical compound with the molecular formula C10H9ClN2OS and a molecular weight of 240.71 g/mol. IUPAC name: 2-chloro-N-[2-(cyanomethylsulfanyl)phenyl]acetamide. InChIKey: PSQPTDYINCRYJB-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2OS |
|---|---|
| Molecular weight | 240.71 g/mol |
| IUPAC name | 2-chloro-N-[2-(cyanomethylsulfanyl)phenyl]acetamide |
| InChIKey | PSQPTDYINCRYJB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)CCl)SCC#N |
Computed by PubChem (NCBI)