CAS 2877-36-3 is the registry number for N-1,3-Benzothiazol-2-yl-3-chloropropanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-(1,3-benzothiazol-2-yl)-3-chloropropanamide (CAS 2877-36-3) is a chemical compound with the molecular formula C10H9ClN2OS and a molecular weight of 240.71 g/mol. IUPAC name: N-(1,3-benzothiazol-2-yl)-3-chloropropanamide. InChIKey: BDRXIJMJSBTEBN-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2OS |
|---|---|
| Molecular weight | 240.71 g/mol |
| IUPAC name | N-(1,3-benzothiazol-2-yl)-3-chloropropanamide |
| InChIKey | BDRXIJMJSBTEBN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)NC(=O)CCCl |
Computed by PubChem (NCBI)