CAS 304685-87-8 is the registry number for 2-Chloro-n-(3-cyano-5,6-dihydro-4h-cyclopenta[b]thiophen-2-yl)-acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-chloro-N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)acetamide (CAS 304685-87-8) is a chemical compound with the molecular formula C10H9ClN2OS and a molecular weight of 240.71 g/mol. IUPAC name: 2-chloro-N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)acetamide. InChIKey: IFPYPHZLEFBRSS-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2OS |
|---|---|
| Molecular weight | 240.71 g/mol |
| IUPAC name | 2-chloro-N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)acetamide |
| InChIKey | IFPYPHZLEFBRSS-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)SC(=C2C#N)NC(=O)CCl |
Computed by PubChem (NCBI)