CAS 26652-09-5 appears in our catalog under these names: Ritodrine, Ritodrine, >98%, >98%. Offered by: Chemat Brand, GLPBio, MedChemExpress, Chemat. Available pack sizes: on request, 100mg, 25mg, 500mg, Get quote, 1g.
4-[2-[[(1R,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]phenol (CAS 26652-09-5) is a chemical compound with the molecular formula C17H21NO3 and a molecular weight of 287.35 g/mol. IUPAC name: 4-[2-[[(1R,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]phenol. InChIKey: IOVGROKTTNBUGK-SJCJKPOMSA-N.
| Molecular formula | C17H21NO3 |
|---|---|
| Molecular weight | 287.35 g/mol |
| IUPAC name | 4-[2-[[(1R,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]phenol |
| InChIKey | IOVGROKTTNBUGK-SJCJKPOMSA-N |
| SMILES | C[C@@H]([C@@H](C1=CC=C(C=C1)O)O)NCCC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)