Products 2665250-56-4
CAS 2665250-56-4 is the registry number for 3-(4-Hydroxynaphthalen-1-yl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-hydroxynaphthalen-1-yl)-2-oxopropanoic acid (CAS 2665250-56-4) is a chemical compound with the molecular formula C13H10O4 and a molecular weight of 230.22 g/mol. IUPAC name: 3-(4-hydroxynaphthalen-1-yl)-2-oxopropanoic acid. InChIKey: BJTUEAYAWPXVGR-UHFFFAOYSA-N.
| Molecular formula | C13H10O4 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 3-(4-hydroxynaphthalen-1-yl)-2-oxopropanoic acid |
| InChIKey | BJTUEAYAWPXVGR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2O)CC(=O)C(=O)O |
Computed by PubChem (NCBI)