Products 2665660-71-7
CAS 2665660-71-7 is the registry number for 2,2-dimethyl-1-pyrrolo[3,2-b]pyridin-1-yl-propan-1-one, 97%, 97%. Offered by: Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g, 25g.
2,2-dimethyl-1-pyrrolo[3,2-b]pyridin-1-ylpropan-1-one (CAS 2665660-71-7) is a chemical compound with the molecular formula C12H14N2O and a molecular weight of 202.25 g/mol. IUPAC name: 2,2-dimethyl-1-pyrrolo[3,2-b]pyridin-1-ylpropan-1-one. InChIKey: WYRWTMUFQWJHCL-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | 2,2-dimethyl-1-pyrrolo[3,2-b]pyridin-1-ylpropan-1-one |
| InChIKey | WYRWTMUFQWJHCL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)N1C=CC2=C1C=CC=N2 |
Computed by PubChem (NCBI)