Products 2672-57-3
CAS 2672-57-3 is the registry number for Trimethyl benzene-1,2,3-tricarboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Trimethyl benzene-1,2,3-tricarboxylate (CAS 2672-57-3) is a chemical compound with the molecular formula C12H12O6 and a molecular weight of 252.22 g/mol. IUPAC name: trimethyl benzene-1,2,3-tricarboxylate. InChIKey: SBOCVSUCRFVXFE-UHFFFAOYSA-N.
| Molecular formula | C12H12O6 |
|---|---|
| Molecular weight | 252.22 g/mol |
| IUPAC name | trimethyl benzene-1,2,3-tricarboxylate |
| InChIKey | SBOCVSUCRFVXFE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
trimethyl 1,2,3-benzenetricarboxylate, trimethyl benzene-1,2,3-tricarboxylate, 1,2,3-benzenetricarboxylic acid, trimethyl ester, Benzene-1,2,3-tricarboxylic acid, trimethyl ester, Benzenetricarboxylic acid, trimethyl ester, 1,2,3-trimethyl benzene-1,2,3-tricarboxylate, SBOCVSUCRFVXFE-UHFFFAOYSA-N, methyl 2,6-bis(methoxycarbonyl)benzoate, 1,2,3-benzene-tricarboxylic acid trimethyl ester, benzene-1,2,3-tricarboxylic acid trimethyl ester