CAS 2673270-41-0 is the registry number for Glioroseinol. Offered by: MedChemExpress. Available pack sizes: Get quote.
(5S,6S)-2,3-dimethoxy-5,6-dimethylcyclohex-2-ene-1,4-dione (CAS 2673270-41-0) is a chemical compound with the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. IUPAC name: (5S,6S)-2,3-dimethoxy-5,6-dimethylcyclohex-2-ene-1,4-dione. InChIKey: OTGRRZBXIQUVOS-WDSKDSINSA-N.
| Molecular formula | C10H14O4 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | (5S,6S)-2,3-dimethoxy-5,6-dimethylcyclohex-2-ene-1,4-dione |
| InChIKey | OTGRRZBXIQUVOS-WDSKDSINSA-N |
| SMILES | C[C@H]1[C@@H](C(=O)C(=C(C1=O)OC)OC)C |
Computed by PubChem (NCBI)