CAS 2673369-03-2 appears in our catalog under these names: 2-Amino-7,7-dimethyl-7,8-dihydro-5H-pyrano(4,3-b)pyridin-5-one, 98%, 2-Amino-7,7-dimethyl-7,8-dihydro-5H-pyrano[4,3-b]pyridin-5-one, 97%, 97%, 2-Amino-7,7-dimethyl-7,8-dihydro-5H-pyrano[4,3-b]pyridin-5-one, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2-amino-7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one (CAS 2673369-03-2) is a chemical compound with the molecular formula C10H12N2O2 and a molecular weight of 192.21 g/mol. IUPAC name: 2-amino-7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one. InChIKey: WXEQQAMGBHPYRY-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O2 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 2-amino-7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one |
| InChIKey | WXEQQAMGBHPYRY-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C=CC(=N2)N)C(=O)O1)C |
Computed by PubChem (NCBI)