Products 267402-35-7
CAS 267402-35-7 is the registry number for (R)-2-(3-Hydroxy-2-methylpropyl)isoindoline-1,3-dione, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-[(2R)-3-hydroxy-2-methylpropyl]isoindole-1,3-dione (CAS 267402-35-7) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: 2-[(2R)-3-hydroxy-2-methylpropyl]isoindole-1,3-dione. InChIKey: DVEGUJIAVRCLNH-MRVPVSSYSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 2-[(2R)-3-hydroxy-2-methylpropyl]isoindole-1,3-dione |
| InChIKey | DVEGUJIAVRCLNH-MRVPVSSYSA-N |
| SMILES | C[C@H](CN1C(=O)C2=CC=CC=C2C1=O)CO |
Computed by PubChem (NCBI)