Products 26767-88-4

CAS 26767-88-4 is the registry number for 2-Amino-2-methylmalonic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-amino-2-methylpropanedioic acid (CAS 26767-88-4) is a chemical compound with the molecular formula C4H7NO4 and a molecular weight of 133.10 g/mol. IUPAC name: 2-amino-2-methylpropanedioic acid. InChIKey: UURVVRAGBFTTCJ-UHFFFAOYSA-N.

Identity
Molecular formulaC4H7NO4
Molecular weight133.10 g/mol
IUPAC name2-amino-2-methylpropanedioic acid
InChIKeyUURVVRAGBFTTCJ-UHFFFAOYSA-N
SMILESCC(C(=O)O)(C(=O)O)N

Computed by PubChem (NCBI)