Products 2676861-99-5
CAS 2676861-99-5 is the registry number for 8-Nitro-1,2,3,5,6,7-hexahydro-s-indacene-1-carbaldehyde, 97%,RG. Offered by: Chemat. Available pack sizes: 100mg.
8-nitro-1,2,3,5,6,7-hexahydro-s-indacene-1-carbaldehyde (CAS 2676861-99-5) is a chemical compound with the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. IUPAC name: 8-nitro-1,2,3,5,6,7-hexahydro-s-indacene-1-carbaldehyde. InChIKey: TUCHFPYJZLIDNB-UHFFFAOYSA-N.
| Molecular formula | C13H13NO3 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 8-nitro-1,2,3,5,6,7-hexahydro-s-indacene-1-carbaldehyde |
| InChIKey | TUCHFPYJZLIDNB-UHFFFAOYSA-N |
| SMILES | C1CC2=CC3=C(C(CC3)C=O)C(=C2C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)