Products 2676867-56-2
CAS 2676867-56-2 is the registry number for 2-Fluoro-2-methyl-8-nitro-3,5,6,7-tetrahydro-s-indacen-1(2H)-one, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
2-fluoro-2-methyl-8-nitro-3,5,6,7-tetrahydro-s-indacen-1-one (CAS 2676867-56-2) is a chemical compound with the molecular formula C13H12FNO3 and a molecular weight of 249.24 g/mol. IUPAC name: 2-fluoro-2-methyl-8-nitro-3,5,6,7-tetrahydro-s-indacen-1-one. InChIKey: JRNKCMLBLMQWCY-UHFFFAOYSA-N.
| Molecular formula | C13H12FNO3 |
|---|---|
| Molecular weight | 249.24 g/mol |
| IUPAC name | 2-fluoro-2-methyl-8-nitro-3,5,6,7-tetrahydro-s-indacen-1-one |
| InChIKey | JRNKCMLBLMQWCY-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C1=O)C(=C3CCCC3=C2)[N+](=O)[O-])F |
Computed by PubChem (NCBI)