Products 2677884-02-3
CAS 2677884-02-3 is the registry number for 3-Cyano-3-methyl-2,3-dihydrobenzofuran-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-cyano-3-methyl-2H-1-benzofuran-5-carboxylic acid (CAS 2677884-02-3) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 3-cyano-3-methyl-2H-1-benzofuran-5-carboxylic acid. InChIKey: VCAUEUTWPITNSO-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 3-cyano-3-methyl-2H-1-benzofuran-5-carboxylic acid |
| InChIKey | VCAUEUTWPITNSO-UHFFFAOYSA-N |
| SMILES | CC1(COC2=C1C=C(C=C2)C(=O)O)C#N |
Computed by PubChem (NCBI)