Products 2677884-39-6
CAS 2677884-39-6 is the registry number for (S)-5-Cyano-5-methyl-5,8-dihydro-6H-pyrano[3,4-b]pyridine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(5S)-5-cyano-5-methyl-6,8-dihydropyrano[3,4-b]pyridine-3-carboxylic acid (CAS 2677884-39-6) is a chemical compound with the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. IUPAC name: (5S)-5-cyano-5-methyl-6,8-dihydropyrano[3,4-b]pyridine-3-carboxylic acid. InChIKey: DIMSDUGRACAHEB-NSHDSACASA-N.
| Molecular formula | C11H10N2O3 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | (5S)-5-cyano-5-methyl-6,8-dihydropyrano[3,4-b]pyridine-3-carboxylic acid |
| InChIKey | DIMSDUGRACAHEB-NSHDSACASA-N |
| SMILES | C[C@@]1(COCC2=C1C=C(C=N2)C(=O)O)C#N |
Computed by PubChem (NCBI)