CAS 267880-78-4 appears in our catalog under these names: 6–(4–Bromophenyl)piperidin–2–one, 6-(4-Bromophenyl)piperidin-2-one, 6-(4-Bromophenyl)piperidin-2-one, 95%. Offered by: GLPBio, Biosynth, AmBeed. Available pack sizes: 100mg, 2,5g, 250mg.
6-(4-bromophenyl)piperidin-2-one (CAS 267880-78-4) is a chemical compound with the molecular formula C11H12BrNO and a molecular weight of 254.12 g/mol. IUPAC name: 6-(4-bromophenyl)piperidin-2-one. InChIKey: SFPGNDANMWJZEN-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO |
|---|---|
| Molecular weight | 254.12 g/mol |
| IUPAC name | 6-(4-bromophenyl)piperidin-2-one |
| InChIKey | SFPGNDANMWJZEN-UHFFFAOYSA-N |
| SMILES | C1CC(NC(=O)C1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)