Products 2680702-76-3
CAS 2680702-76-3 is the registry number for tert-Butyl (6-chloro-3-oxo-2,3-dihydropyridazin-4-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(3-chloro-6-oxo-1H-pyridazin-5-yl)carbamate (CAS 2680702-76-3) is a chemical compound with the molecular formula C9H12ClN3O3 and a molecular weight of 245.66 g/mol. IUPAC name: tert-butyl N-(3-chloro-6-oxo-1H-pyridazin-5-yl)carbamate. InChIKey: BNXGJDQQPDVQOY-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN3O3 |
|---|---|
| Molecular weight | 245.66 g/mol |
| IUPAC name | tert-butyl N-(3-chloro-6-oxo-1H-pyridazin-5-yl)carbamate |
| InChIKey | BNXGJDQQPDVQOY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=NNC1=O)Cl |
Computed by PubChem (NCBI)