CAS 31796-55-1 appears in our catalog under these names: H-Ala-pna hydrochloride, 98%, L-Alanine 4-nitroanilide hydrochloride, 98+%, H–Ala–pNA·HCl, H-L-Ala-pNA*HCl, L-Alanine 4-nitroanilide hydrochloride, 98% . Offered by: Combi-blocks, AmBeed, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar). Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 50g, 100g, 100MG.
(2S)-2-amino-N-(4-nitrophenyl)propanamide;hydrochloride (CAS 31796-55-1) is a chemical compound with the molecular formula C9H12ClN3O3 and a molecular weight of 245.66 g/mol. IUPAC name: (2S)-2-amino-N-(4-nitrophenyl)propanamide;hydrochloride. InChIKey: YEXRLSXNWLNHQR-RGMNGODLSA-N.
| Molecular formula | C9H12ClN3O3 |
|---|---|
| Molecular weight | 245.66 g/mol |
| IUPAC name | (2S)-2-amino-N-(4-nitrophenyl)propanamide;hydrochloride |
| InChIKey | YEXRLSXNWLNHQR-RGMNGODLSA-N |
| SMILES | C[C@@H](C(=O)NC1=CC=C(C=C1)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)