Products 730997-77-0
CAS 730997-77-0 appears in our catalog under these names: 6-Amino-5-(2-chloropropanoyl)-1,3-dimethylpyrimidine-2,4(1h,3h)-dione, 95%, 6-Amino-5-(2-chloropropanoyl)-1,3-dimethyl-1,2,3,4-tetrahydropyrimidine-2,4-dione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
6-amino-5-(2-chloropropanoyl)-1,3-dimethylpyrimidine-2,4-dione (CAS 730997-77-0) is a chemical compound with the molecular formula C9H12ClN3O3 and a molecular weight of 245.66 g/mol. IUPAC name: 6-amino-5-(2-chloropropanoyl)-1,3-dimethylpyrimidine-2,4-dione. InChIKey: BFRSUNXCACCUHG-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN3O3 |
|---|---|
| Molecular weight | 245.66 g/mol |
| IUPAC name | 6-amino-5-(2-chloropropanoyl)-1,3-dimethylpyrimidine-2,4-dione |
| InChIKey | BFRSUNXCACCUHG-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=C(N(C(=O)N(C1=O)C)C)N)Cl |
Computed by PubChem (NCBI)