CAS 81679-07-4 is the registry number for Ethyl 5-(2-chloroacetamido)-1-methyl-1H-pyrazole-4-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Ethyl 5-[(2-chloroacetyl)amino]-1-methylpyrazole-4-carboxylate (CAS 81679-07-4) is a chemical compound with the molecular formula C9H12ClN3O3 and a molecular weight of 245.66 g/mol. IUPAC name: ethyl 5-[(2-chloroacetyl)amino]-1-methylpyrazole-4-carboxylate. InChIKey: FRPNFJSPPQTIEO-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN3O3 |
|---|---|
| Molecular weight | 245.66 g/mol |
| IUPAC name | ethyl 5-[(2-chloroacetyl)amino]-1-methylpyrazole-4-carboxylate |
| InChIKey | FRPNFJSPPQTIEO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)C)NC(=O)CCl |
Computed by PubChem (NCBI)