CAS 2682097-26-1 appears in our catalog under these names: (R)-Methyl 2-amino-3-(2-fluoro-4-methylphenyl)propanoate hydrochloride, 95%, 95%, METHYL (2R)-2-AMINO-3-(2-FLUORO-4-METHYLPHENYL)PROPANOATE HYDROCHLORIDE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
Methyl (2R)-2-amino-3-(2-fluoro-4-methylphenyl)propanoate;hydrochloride (CAS 2682097-26-1) is a chemical compound with the molecular formula C11H15ClFNO2 and a molecular weight of 247.69 g/mol. IUPAC name: methyl (2R)-2-amino-3-(2-fluoro-4-methylphenyl)propanoate;hydrochloride. InChIKey: YBLZZFBEIRJLNP-HNCPQSOCSA-N.
| Molecular formula | C11H15ClFNO2 |
|---|---|
| Molecular weight | 247.69 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(2-fluoro-4-methylphenyl)propanoate;hydrochloride |
| InChIKey | YBLZZFBEIRJLNP-HNCPQSOCSA-N |
| SMILES | CC1=CC(=C(C=C1)C[C@H](C(=O)OC)N)F.Cl |
Computed by PubChem (NCBI)