Products 2682114-49-2
CAS 2682114-49-2 is the registry number for 2-(Piperazin-1-yl)isonicotinic acid hydrochloride, 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-piperazin-1-ylpyridine-4-carboxylic acid;hydrochloride (CAS 2682114-49-2) is a chemical compound with the molecular formula C10H14ClN3O2 and a molecular weight of 243.69 g/mol. IUPAC name: 2-piperazin-1-ylpyridine-4-carboxylic acid;hydrochloride. InChIKey: UCQIQRVKTQPGTI-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN3O2 |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | 2-piperazin-1-ylpyridine-4-carboxylic acid;hydrochloride |
| InChIKey | UCQIQRVKTQPGTI-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC=CC(=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)