CAS 26829-43-6 appears in our catalog under these names: 6-Methoxyisoquinolin-1(2H)-one 95%, 6-Methoxyisoquin-1(2H)-one, 98%, 6-Methoxyisoquinolin-1(2H)-one, 95%, 95%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
6-methoxy-2H-isoquinolin-1-one (CAS 26829-43-6) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 6-methoxy-2H-isoquinolin-1-one. InChIKey: DDLJWWYULDUBGA-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 6-methoxy-2H-isoquinolin-1-one |
| InChIKey | DDLJWWYULDUBGA-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=O)NC=C2 |
Computed by PubChem (NCBI)