CAS 2687959-99-3 appears in our catalog under these names: Gluconate–1–13C sodium, Gluconate-1-13C (sodium), 99.89%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 5 mg, 10 mg.
Sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy(113C)hexanoate (CAS 2687959-99-3) is a chemical compound with the molecular formula C6H11NaO7 and a molecular weight of 219.13 g/mol. IUPAC name: sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy(113C)hexanoate. InChIKey: UPMFZISCCZSDND-RYHRKSQGSA-M.
| Molecular formula | C6H11NaO7 |
|---|---|
| Molecular weight | 219.13 g/mol |
| IUPAC name | sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy(113C)hexanoate |
| InChIKey | UPMFZISCCZSDND-RYHRKSQGSA-M |
| SMILES | C([C@H]([C@H]([C@@H]([C@H]([13C](=O)[O-])O)O)O)O)O.[Na+] |
Computed by PubChem (NCBI)