Products 26903-90-2
CAS 26903-90-2 is the registry number for 5-Chloro-3-(3,5-dimethoxyphenyl)-1,2,4-oxadiazole. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-chloro-3-(3,5-dimethoxyphenyl)-1,2,4-oxadiazole (CAS 26903-90-2) is a chemical compound with the molecular formula C10H9ClN2O3 and a molecular weight of 240.64 g/mol. IUPAC name: 5-chloro-3-(3,5-dimethoxyphenyl)-1,2,4-oxadiazole. InChIKey: RVOCAEMKKUEUMS-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O3 |
|---|---|
| Molecular weight | 240.64 g/mol |
| IUPAC name | 5-chloro-3-(3,5-dimethoxyphenyl)-1,2,4-oxadiazole |
| InChIKey | RVOCAEMKKUEUMS-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C2=NOC(=N2)Cl)OC |
Computed by PubChem (NCBI)