CAS 26907-54-0 appears in our catalog under these names: 2–Amino–5–(4–methylphenyl)–1,3,4–thiadiazole, 5-(p-Tolyl)-1,3,4-thiadiazol-2-amine, 98%, 98%, 5-p-Tolyl[1,3,4]thiadiazol-2-ylamine, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg, 10g, 100g.
5-(4-methylphenyl)-1,3,4-thiadiazol-2-amine (CAS 26907-54-0) is a chemical compound with the molecular formula C9H9N3S and a molecular weight of 191.26 g/mol. IUPAC name: 5-(4-methylphenyl)-1,3,4-thiadiazol-2-amine. InChIKey: ZLDPCNCAFSBFCX-UHFFFAOYSA-N.
| Molecular formula | C9H9N3S |
|---|---|
| Molecular weight | 191.26 g/mol |
| IUPAC name | 5-(4-methylphenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | ZLDPCNCAFSBFCX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NN=C(S2)N |
Computed by PubChem (NCBI)