Products 2694069-59-3
CAS 2694069-59-3 appears in our catalog under these names: (2S)-2-Amino-3-(indolin-3-yl)propanoic acid HCl, 95%, (2S)-2-Amino-3-(indolin-3-yl)propanoic acid hydrochloride, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(2S)-2-amino-3-(2,3-dihydro-1H-indol-3-yl)propanoic acid;hydrochloride (CAS 2694069-59-3) is a chemical compound with the molecular formula C11H15ClN2O2 and a molecular weight of 242.70 g/mol. IUPAC name: (2S)-2-amino-3-(2,3-dihydro-1H-indol-3-yl)propanoic acid;hydrochloride. InChIKey: HLNYSJIVWQQRNR-ABKGKFHGSA-N.
| Molecular formula | C11H15ClN2O2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | (2S)-2-amino-3-(2,3-dihydro-1H-indol-3-yl)propanoic acid;hydrochloride |
| InChIKey | HLNYSJIVWQQRNR-ABKGKFHGSA-N |
| SMILES | C1C(C2=CC=CC=C2N1)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)