CAS 2696341-27-0 is the registry number for 2-fluoro-3-methyl-6-(trifluoromethyl)pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
2-fluoro-3-methyl-6-(trifluoromethyl)pyridine (CAS 2696341-27-0) is a chemical compound with the molecular formula C7H5F4N and a molecular weight of 179.11 g/mol. IUPAC name: 2-fluoro-3-methyl-6-(trifluoromethyl)pyridine. InChIKey: NLICRQQBXDNMEB-UHFFFAOYSA-N.
| Molecular formula | C7H5F4N |
|---|---|
| Molecular weight | 179.11 g/mol |
| IUPAC name | 2-fluoro-3-methyl-6-(trifluoromethyl)pyridine |
| InChIKey | NLICRQQBXDNMEB-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(C=C1)C(F)(F)F)F |
Computed by PubChem (NCBI)