Products 269726-79-6
CAS 269726-79-6 appears in our catalog under these names: (R)-3-Amino-4-(2-cyanophenyl)butanoic acid hydrochloride, 95%, H-D-β-HoPhe(2-CN)-OH, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
(3R)-3-amino-4-(2-cyanophenyl)butanoic acid;hydrochloride (CAS 269726-79-6) is a chemical compound with the molecular formula C11H13ClN2O2 and a molecular weight of 240.68 g/mol. IUPAC name: (3R)-3-amino-4-(2-cyanophenyl)butanoic acid;hydrochloride. InChIKey: YUGYFQMRAJZGBQ-HNCPQSOCSA-N.
| Molecular formula | C11H13ClN2O2 |
|---|---|
| Molecular weight | 240.68 g/mol |
| IUPAC name | (3R)-3-amino-4-(2-cyanophenyl)butanoic acid;hydrochloride |
| InChIKey | YUGYFQMRAJZGBQ-HNCPQSOCSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@H](CC(=O)O)N)C#N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(R)-3-Amino-4-(2-cyano-phenyl)-butyric acid-HCl, (3R)-3-amino-4-(2-cyanophenyl)butanoic acid;hydrochloride, 2-Cyano-D-b-homophenylalanine hydrochloride, H-D-beta-HPhe(2-CN)-OH, (R)-3-Amino-4-(2-cyano-phenyl)-butyric acid HCl, (3R)-3-Amino-4-(2-cyanophenyl)butanoic acid--hydrogen chloride (1/1)