Products 2698398-70-6
CAS 2698398-70-6 is the registry number for 2-(2,6-Dioxopiperidin-3-yl)phthalimidine-azetidine. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[6-(azetidin-3-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (CAS 2698398-70-6) is a chemical compound with the molecular formula C16H17N3O3 and a molecular weight of 299.32 g/mol. IUPAC name: 3-[6-(azetidin-3-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione. InChIKey: FAGLMWRRDFQGBG-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O3 |
|---|---|
| Molecular weight | 299.32 g/mol |
| IUPAC name | 3-[6-(azetidin-3-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| InChIKey | FAGLMWRRDFQGBG-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC(=C3)C4CNC4 |
Computed by PubChem (NCBI)