Products 26988-87-4
CAS 26988-87-4 is the registry number for D,L-Homotryptophan. Offered by: TRC. Available pack sizes: 50mg, 5mg.
2-amino-4-(1H-indol-3-yl)butanoic acid (CAS 26988-87-4) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: 2-amino-4-(1H-indol-3-yl)butanoic acid. InChIKey: ADJZXDVMJPTFKT-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 2-amino-4-(1H-indol-3-yl)butanoic acid |
| InChIKey | ADJZXDVMJPTFKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCC(C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
alpha-Amino-1H-indole-3-butanoic acid, D,L-Homotryptophan, 2-amino-4-(1H-indol-3-yl)butanoic Acid, DL-Homotryptophan, A-Amino-G-(3-indole)butyric acid, ?-Amino-1H-indole-3-butanoic acid, ?-Amino-?-(3-indole)-butyric acid, I+/--Amino-1H-indole-3-butanoic acid, 2-amino-4-(1H-indol-3-yl)butanoicAcid