Products 2700080-54-0

CAS 2700080-54-0 is the registry number for Pilocarpine hydrochloride Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(3R)-2-ethyl-3-(hydroxymethyl)-4-(3-methylimidazol-4-yl)butanoic acid (CAS 2700080-54-0) is a chemical compound with the molecular formula C11H18N2O3 and a molecular weight of 226.27 g/mol. IUPAC name: (3R)-2-ethyl-3-(hydroxymethyl)-4-(3-methylimidazol-4-yl)butanoic acid. InChIKey: WJRPDGADPABWOY-PEHGTWAWSA-N.

Identity
Molecular formulaC11H18N2O3
Molecular weight226.27 g/mol
IUPAC name(3R)-2-ethyl-3-(hydroxymethyl)-4-(3-methylimidazol-4-yl)butanoic acid
InChIKeyWJRPDGADPABWOY-PEHGTWAWSA-N
SMILESCCC([C@@H](CC1=CN=CN1C)CO)C(=O)O

Computed by PubChem (NCBI)