Products 34350-99-7

CAS 34350-99-7 is the registry number for Pilocarpine hydrochloride EP Impurity C. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2R,3R)-2-ethyl-3-(hydroxymethyl)-4-(3-methylimidazol-4-yl)butanoic acid (CAS 34350-99-7) is a chemical compound with the molecular formula C11H18N2O3 and a molecular weight of 226.27 g/mol. IUPAC name: (2R,3R)-2-ethyl-3-(hydroxymethyl)-4-(3-methylimidazol-4-yl)butanoic acid. InChIKey: WJRPDGADPABWOY-WCBMZHEXSA-N.

Identity
Molecular formulaC11H18N2O3
Molecular weight226.27 g/mol
IUPAC name(2R,3R)-2-ethyl-3-(hydroxymethyl)-4-(3-methylimidazol-4-yl)butanoic acid
InChIKeyWJRPDGADPABWOY-WCBMZHEXSA-N
SMILESCC[C@H]([C@@H](CC1=CN=CN1C)CO)C(=O)O

Computed by PubChem (NCBI)