Products 28406-15-7
CAS 28406-15-7 is the registry number for Pilocarpine hydrochloride EP Impurity B. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3R)-2-ethyl-3-(hydroxymethyl)-4-(3-methylimidazol-4-yl)butanoic acid (CAS 28406-15-7) is a chemical compound with the molecular formula C11H18N2O3 and a molecular weight of 226.27 g/mol. IUPAC name: (2S,3R)-2-ethyl-3-(hydroxymethyl)-4-(3-methylimidazol-4-yl)butanoic acid. InChIKey: WJRPDGADPABWOY-WPRPVWTQSA-N.
| Molecular formula | C11H18N2O3 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | (2S,3R)-2-ethyl-3-(hydroxymethyl)-4-(3-methylimidazol-4-yl)butanoic acid |
| InChIKey | WJRPDGADPABWOY-WPRPVWTQSA-N |
| SMILES | CC[C@@H]([C@@H](CC1=CN=CN1C)CO)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Pilocarpic acid, (2R,3R)-2-ethyl-3-(hydroxymethyl)-4-(3-methyl-4-imidazolyl)butanoic acid, Pilocarpine Hydrochloride EP Impurity B, (2S,3R)-2-ethyl-3-(hydroxymethyl)-4-(3-methylimidazol-4-yl)butanoic acid, (2S,3R)-2-Ethyl-4-hydroxy-3-((1-methyl-1H-imidazol-5-yl)methyl)butanoic acid, Pilocarpinsaure, PILOCARPINE NITRATE IMPURITY B [EP IMPURITY], PILOCARPINE HYDROCHLORIDE IMPURITY B [EP IMPURITY], PILOCARPINE HYDROCHLORIDE IMPURITY PILOCARPIC ACID [USP IMPURITY]