CAS 270263-03-1 appears in our catalog under these names: Boc-(s)-3-amino-5-hexenoic acid, 95%, (S)-3-((tert-Butoxycarbonyl)amino)hex-5-enoic acid, 98%, 98%, (S)-3-((tert-Butoxycarbonyl)amino)hex-5-enoic acid, 98%, Boc-β-HoGly(Allyl)-OH, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 5g.
(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoic acid (CAS 270263-03-1) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoic acid. InChIKey: RFHPQLCVYMBPRF-QMMMGPOBSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoic acid |
| InChIKey | RFHPQLCVYMBPRF-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC=C)CC(=O)O |
Computed by PubChem (NCBI)