Products 2703697-00-9
CAS 2703697-00-9 is the registry number for Benzyl (R)-3-(bromomethyl)pyrrolidine-1-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Benzyl (3R)-3-(bromomethyl)pyrrolidine-1-carboxylate (CAS 2703697-00-9) is a chemical compound with the molecular formula C13H16BrNO2 and a molecular weight of 298.18 g/mol. IUPAC name: benzyl (3R)-3-(bromomethyl)pyrrolidine-1-carboxylate. InChIKey: ZLMUAHPVUGYWKX-LBPRGKRZSA-N.
| Molecular formula | C13H16BrNO2 |
|---|---|
| Molecular weight | 298.18 g/mol |
| IUPAC name | benzyl (3R)-3-(bromomethyl)pyrrolidine-1-carboxylate |
| InChIKey | ZLMUAHPVUGYWKX-LBPRGKRZSA-N |
| SMILES | C1CN(C[C@@H]1CBr)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)