Products 2703746-36-3
CAS 2703746-36-3 is the registry number for (S)-6-Methoxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
(1S)-6-methoxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid;hydrochloride (CAS 2703746-36-3) is a chemical compound with the molecular formula C11H14ClNO3 and a molecular weight of 243.68 g/mol. IUPAC name: (1S)-6-methoxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid;hydrochloride. InChIKey: UUWFHMARMBMUOJ-PPHPATTJSA-N.
| Molecular formula | C11H14ClNO3 |
|---|---|
| Molecular weight | 243.68 g/mol |
| IUPAC name | (1S)-6-methoxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid;hydrochloride |
| InChIKey | UUWFHMARMBMUOJ-PPHPATTJSA-N |
| SMILES | COC1=CC2=C(C=C1)[C@H](NCC2)C(=O)O.Cl |
Computed by PubChem (NCBI)