Products 2703757-06-4
CAS 2703757-06-4 is the registry number for 7-Hydroxy-1,5-naphthyridine-3-carboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
7-hydroxy-1,5-naphthyridine-3-carboxylic acid (CAS 2703757-06-4) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 7-hydroxy-1,5-naphthyridine-3-carboxylic acid. InChIKey: XFLFIQJIUJUZSE-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 7-hydroxy-1,5-naphthyridine-3-carboxylic acid |
| InChIKey | XFLFIQJIUJUZSE-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1N=CC(=C2)O)C(=O)O |
Computed by PubChem (NCBI)