Products 2703855-39-2
CAS 2703855-39-2 appears in our catalog under these names: cis-2-(trifluoromethyl)piperidine-4-carboxylic acid,hydrochloride, 97%, 97%, cis-2-(Trifluoromethyl)piperidine-4-carboxylic acid hydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
(2R,4S)-2-(trifluoromethyl)piperidine-4-carboxylic acid;hydrochloride (CAS 2703855-39-2) is a chemical compound with the molecular formula C7H11ClF3NO2 and a molecular weight of 233.61 g/mol. IUPAC name: (2R,4S)-2-(trifluoromethyl)piperidine-4-carboxylic acid;hydrochloride. InChIKey: MSUATQFDGCXRGM-UYXJWNHNSA-N.
| Molecular formula | C7H11ClF3NO2 |
|---|---|
| Molecular weight | 233.61 g/mol |
| IUPAC name | (2R,4S)-2-(trifluoromethyl)piperidine-4-carboxylic acid;hydrochloride |
| InChIKey | MSUATQFDGCXRGM-UYXJWNHNSA-N |
| SMILES | C1CN[C@H](C[C@H]1C(=O)O)C(F)(F)F.Cl |
Computed by PubChem (NCBI)