Products 2703917-01-3
CAS 2703917-01-3 is the registry number for 2-(4-(2,6-Dioxopiperidin-3-yl)phenyl)acetaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-(2,6-dioxopiperidin-3-yl)phenyl]acetaldehyde (CAS 2703917-01-3) is a chemical compound with the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. IUPAC name: 2-[4-(2,6-dioxopiperidin-3-yl)phenyl]acetaldehyde. InChIKey: ADOQHFGLQCJEOU-UHFFFAOYSA-N.
| Molecular formula | C13H13NO3 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 2-[4-(2,6-dioxopiperidin-3-yl)phenyl]acetaldehyde |
| InChIKey | ADOQHFGLQCJEOU-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=CC=C(C=C2)CC=O |
Computed by PubChem (NCBI)