Products 2704523-26-0
CAS 2704523-26-0 is the registry number for (R)-2-(PIPERAZIN-2-YL)PROPAN-2-OL DIHYDROCHLORIDE, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-[(2R)-piperazin-2-yl]propan-2-ol;dihydrochloride (CAS 2704523-26-0) is a chemical compound with the molecular formula C7H18Cl2N2O and a molecular weight of 217.13 g/mol. IUPAC name: 2-[(2R)-piperazin-2-yl]propan-2-ol;dihydrochloride. InChIKey: HGZHFQRHNUAMJB-QYCVXMPOSA-N.
| Molecular formula | C7H18Cl2N2O |
|---|---|
| Molecular weight | 217.13 g/mol |
| IUPAC name | 2-[(2R)-piperazin-2-yl]propan-2-ol;dihydrochloride |
| InChIKey | HGZHFQRHNUAMJB-QYCVXMPOSA-N |
| SMILES | CC(C)([C@H]1CNCCN1)O.Cl.Cl |
Computed by PubChem (NCBI)