Products 2705237-34-7
CAS 2705237-34-7 is the registry number for tert-butyl 6-bromo-3,3-dimethyl-2H-pyrrolo[2,3-b]pyridine-1-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl 6-bromo-3,3-dimethyl-2H-pyrrolo[2,3-b]pyridine-1-carboxylate (CAS 2705237-34-7) is a chemical compound with the molecular formula C14H19BrN2O2 and a molecular weight of 327.22 g/mol. IUPAC name: tert-butyl 6-bromo-3,3-dimethyl-2H-pyrrolo[2,3-b]pyridine-1-carboxylate. InChIKey: GWIRCQXZNPYBHY-UHFFFAOYSA-N.
| Molecular formula | C14H19BrN2O2 |
|---|---|
| Molecular weight | 327.22 g/mol |
| IUPAC name | tert-butyl 6-bromo-3,3-dimethyl-2H-pyrrolo[2,3-b]pyridine-1-carboxylate |
| InChIKey | GWIRCQXZNPYBHY-UHFFFAOYSA-N |
| SMILES | CC1(CN(C2=C1C=CC(=N2)Br)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)