CAS 2705846-19-9 is the registry number for Mono(2-ethyl-5-hydroxyhexyl) Phthalate-13C6. Offered by: TRC. Available pack sizes: 75mg.
6-(2-ethyl-5-hydroxyhexoxy)carbonyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid (CAS 2705846-19-9) is a chemical compound with the molecular formula C16H22O5 and a molecular weight of 300.30 g/mol. IUPAC name: 6-(2-ethyl-5-hydroxyhexoxy)carbonyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid. InChIKey: RYPQSGURZSTFSX-ANBMRESWSA-N.
| Molecular formula | C16H22O5 |
|---|---|
| Molecular weight | 300.30 g/mol |
| IUPAC name | 6-(2-ethyl-5-hydroxyhexoxy)carbonyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid |
| InChIKey | RYPQSGURZSTFSX-ANBMRESWSA-N |
| SMILES | CCC(CCC(C)O)COC(=O)[13C]1=[13CH][13CH]=[13CH][13CH]=[13C]1C(=O)O |
Computed by PubChem (NCBI)