Products 41478-45-9

CAS 41478-45-9 is the registry number for Diethyl 2-(2-(benzyloxy)ethyl)malonate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Diethyl 2-(2-phenylmethoxyethyl)propanedioate (CAS 41478-45-9) is a chemical compound with the molecular formula C16H22O5 and a molecular weight of 294.34 g/mol. IUPAC name: diethyl 2-(2-phenylmethoxyethyl)propanedioate. InChIKey: FFBDKROYDQHPHC-UHFFFAOYSA-N.

Identity
Molecular formulaC16H22O5
Molecular weight294.34 g/mol
IUPAC namediethyl 2-(2-phenylmethoxyethyl)propanedioate
InChIKeyFFBDKROYDQHPHC-UHFFFAOYSA-N
SMILESCCOC(=O)C(CCOCC1=CC=CC=C1)C(=O)OCC

Computed by PubChem (NCBI)