Products 856869-58-4

CAS 856869-58-4 is the registry number for Mono-8-hydroxyoctyl Phthalate. Offered by: TRC. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

2-(8-hydroxyoctoxycarbonyl)benzoic acid (CAS 856869-58-4) is a chemical compound with the molecular formula C16H22O5 and a molecular weight of 294.34 g/mol. IUPAC name: 2-(8-hydroxyoctoxycarbonyl)benzoic acid. InChIKey: CKASXCCQWJHYCJ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H22O5
Molecular weight294.34 g/mol
IUPAC name2-(8-hydroxyoctoxycarbonyl)benzoic acid
InChIKeyCKASXCCQWJHYCJ-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)O)C(=O)OCCCCCCCCO

Computed by PubChem (NCBI)