Products 679789-43-6
CAS 679789-43-6 appears in our catalog under these names: Mono(2-ethyl-5-hydroxyhexyl) Phthalate-d4 (Mixture of Diastereomers), >95% (HPLC), Mono(2–ethyl–5–hydroxyhexyl) phthalate–d4, Mono(2-ethyl-5-hydroxyhexyl) phthalate-d4, 96.23%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 0,5mg, 10mg, 1mg, 500μg, 1 mg, 500 μg.
2,3,4,5-tetradeuterio-6-(2-ethyl-5-hydroxyhexoxy)carbonylbenzoic acid (CAS 679789-43-6) is a chemical compound with the molecular formula C16H22O5 and a molecular weight of 298.37 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-(2-ethyl-5-hydroxyhexoxy)carbonylbenzoic acid. InChIKey: RYPQSGURZSTFSX-UGWFXTGHSA-N.
| Molecular formula | C16H22O5 |
|---|---|
| Molecular weight | 298.37 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-(2-ethyl-5-hydroxyhexoxy)carbonylbenzoic acid |
| InChIKey | RYPQSGURZSTFSX-UGWFXTGHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)C(=O)OCC(CC)CCC(C)O)[2H])[2H] |
Computed by PubChem (NCBI)