CAS 2708286-66-0 appears in our catalog under these names: Rel-(1R,2S,4S)-4-amino-2-methylcyclohexane-1-carboxylic acid hydrochloride, 97%, rel-(1S,2R,4R)-4-amino-2-methyl-cyclohexanecarboxylic acid,hydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
(1S,2R,4R)-4-amino-2-methylcyclohexane-1-carboxylic acid;hydrochloride (CAS 2708286-66-0) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: (1S,2R,4R)-4-amino-2-methylcyclohexane-1-carboxylic acid;hydrochloride. InChIKey: WVDBXEMRJRKDJF-IXUZKAFRSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | (1S,2R,4R)-4-amino-2-methylcyclohexane-1-carboxylic acid;hydrochloride |
| InChIKey | WVDBXEMRJRKDJF-IXUZKAFRSA-N |
| SMILES | C[C@@H]1C[C@@H](CC[C@@H]1C(=O)O)N.Cl |
Computed by PubChem (NCBI)