Products 2708288-10-0
CAS 2708288-10-0 is the registry number for 6-(trifluoromethyl)-2,3-dihydrobenzofuran-3-ol, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
6-(trifluoromethyl)-2,3-dihydro-1-benzofuran-3-ol (CAS 2708288-10-0) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: 6-(trifluoromethyl)-2,3-dihydro-1-benzofuran-3-ol. InChIKey: AATADWIOIAOAAQ-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O2 |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | 6-(trifluoromethyl)-2,3-dihydro-1-benzofuran-3-ol |
| InChIKey | AATADWIOIAOAAQ-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(O1)C=C(C=C2)C(F)(F)F)O |
Computed by PubChem (NCBI)