Products 2708343-25-1
CAS 2708343-25-1 is the registry number for (R)-1-(3-(Methylsulfonyl)phenyl)ethan-1-amine hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(1R)-1-(3-methylsulfonylphenyl)ethanamine;hydrochloride (CAS 2708343-25-1) is a chemical compound with the molecular formula C9H14ClNO2S and a molecular weight of 235.73 g/mol. IUPAC name: (1R)-1-(3-methylsulfonylphenyl)ethanamine;hydrochloride. InChIKey: WPUWGOYXNWHBQX-OGFXRTJISA-N.
| Molecular formula | C9H14ClNO2S |
|---|---|
| Molecular weight | 235.73 g/mol |
| IUPAC name | (1R)-1-(3-methylsulfonylphenyl)ethanamine;hydrochloride |
| InChIKey | WPUWGOYXNWHBQX-OGFXRTJISA-N |
| SMILES | C[C@H](C1=CC(=CC=C1)S(=O)(=O)C)N.Cl |
Computed by PubChem (NCBI)