CAS 76697-54-6 is the registry number for 2-(Propanesulfonyl)aniline hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-propylsulfonylaniline;hydrochloride (CAS 76697-54-6) is a chemical compound with the molecular formula C9H14ClNO2S and a molecular weight of 235.73 g/mol. IUPAC name: 2-propylsulfonylaniline;hydrochloride. InChIKey: JCZWMVOWZZHONS-UHFFFAOYSA-N.
| Molecular formula | C9H14ClNO2S |
|---|---|
| Molecular weight | 235.73 g/mol |
| IUPAC name | 2-propylsulfonylaniline;hydrochloride |
| InChIKey | JCZWMVOWZZHONS-UHFFFAOYSA-N |
| SMILES | CCCS(=O)(=O)C1=CC=CC=C1N.Cl |
Computed by PubChem (NCBI)